2,2',5-Trimethoxybenzophenone structure
|
Common Name | 2,2',5-Trimethoxybenzophenone | ||
|---|---|---|---|---|
| CAS Number | 32938-33-3 | Molecular Weight | 272.29600 | |
| Density | 1.136g/cm3 | Boiling Point | 444ºC at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | (2,5-dimethoxyphenyl)-(2-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.136g/cm3 |
|---|---|
| Boiling Point | 444ºC at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Flash Point | 197.9ºC |
| Exact Mass | 272.10500 |
| PSA | 44.76000 |
| LogP | 2.94340 |
| Index of Refraction | 1.547 |
| InChIKey | JHXMMMMAUMABDT-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(C(=O)c2ccccc2OC)c1 |
| HS Code | 2914509090 |
|---|
|
~87%
2,2',5-Trimetho... CAS#:32938-33-3 |
| Literature: Han; Bontems; Hegyes; Munson; Minor; Kates; Albericio; Barany Journal of Organic Chemistry, 1996 , vol. 61, # 18 p. 6326 - 6339 |
|
~%
2,2',5-Trimetho... CAS#:32938-33-3 |
| Literature: Tomioka, Hideo; Kimoto, Kohji; Murata, Hiroshi; Izawa, Yasuji Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 2 p. 471 - 477 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Trimethoxy-2.2'.5' benzophenon |
| BENZOPHENONE,2,2',5-TRIMETHOXY |
| 2,2',5'-trimethoxybenzophenone |