alpha-((Diethylamino)methyl)-p-((1-methoxy-6-nitro-9-acridinyl)amino)b enzyl alcohol structure
|
Common Name | alpha-((Diethylamino)methyl)-p-((1-methoxy-6-nitro-9-acridinyl)amino)b enzyl alcohol | ||
|---|---|---|---|---|
| CAS Number | 32951-81-8 | Molecular Weight | 460.52500 | |
| Density | 1.289g/cm3 | Boiling Point | 649.8ºC at 760mmHg | |
| Molecular Formula | C26H28N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 346.8ºC | |
| Name | 2-(diethylamino)-1-[4-[(1-methoxy-6-nitroacridin-9-yl)amino]phenyl]ethanol |
|---|
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 649.8ºC at 760mmHg |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.52500 |
| Flash Point | 346.8ºC |
| Exact Mass | 460.21100 |
| PSA | 106.67000 |
| LogP | 5.36870 |
| Index of Refraction | 1.686 |
| InChIKey | FYXJUPOZPYRULI-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(O)c1ccc(Nc2c3ccc([N+](=O)[O-])cc3nc3cccc(OC)c23)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |