(6-((((4-Methylphenyl)sulfonyl)oxy)methyl)-3-cyclohexen-1-yl)methyl 4-methylbenzenesulfonate structure
|
Common Name | (6-((((4-Methylphenyl)sulfonyl)oxy)methyl)-3-cyclohexen-1-yl)methyl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 32970-96-0 | Molecular Weight | 450.56800 | |
| Density | 1.253g/cm3 | Boiling Point | 605.7ºC at 760mmHg | |
| Molecular Formula | C22H26O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.1ºC | |
| Name | [6-[(4-methylphenyl)sulfonyloxymethyl]cyclohex-3-en-1-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 605.7ºC at 760mmHg |
| Molecular Formula | C22H26O6S2 |
| Molecular Weight | 450.56800 |
| Flash Point | 320.1ºC |
| Exact Mass | 450.11700 |
| PSA | 103.50000 |
| LogP | 6.15820 |
| InChIKey | IJTLQNHNJKDWSK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC=CCC2COS(=O)(=O)c2ccc(C)cc2)cc1 |
| HS Code | 2904100000 |
|---|
|
~88%
(6-((((4-Methyl... CAS#:32970-96-0 |
| Literature: Zheng; DeMattei; Wu; Duan; Cook; Oinuma; Kishi Journal of the American Chemical Society, 1996 , vol. 118, # 34 p. 7946 - 7968 |
|
~%
(6-((((4-Methyl... CAS#:32970-96-0 |
| Literature: Casadevall,E. et al. Bulletin de la Societe Chimique de France, 1968 , p. 1514 - 1524 |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| (6-((((4-Methylphenyl)sulfonyl)oxy)methyl)-3-cyclohexen-1-yl)methyl 4-methylbenzenesulfonate |
| cis-1,2-Bis-(p-tosyloxymethyl)-cyclohexen-(4) |
| cis-1,2,3,6-tetrahydrophthalyl alcohol di-p-toluenesulfonate |
| ghl.PD_Mitscher_leg0.665 |
| cis-4,5-bis-(toluene-4-sulfonyloxymethyl)-cyclohexene |
| cis-4,5-di(p-toluene sulphonoxymethyl)cyclohexene |
| cis-4,5-Bis-(p-tosyloxymethyl)-cyclohexen |
| cis-4,5-Bis-(toluol-4-sulfonyloxymethyl)-cyclohexen |
| meso-4,5-bis<(tosyloxy)methyl>cyclohexene |