nicotinic acid, compound with alpha-[(butylamino)methyl]-p-hydroxybenzyl alcohol structure
|
Common Name | nicotinic acid, compound with alpha-[(butylamino)methyl]-p-hydroxybenzyl alcohol | ||
|---|---|---|---|---|
| CAS Number | 32981-34-3 | Molecular Weight | 332.39400 | |
| Density | N/A | Boiling Point | 375.2ºC at 760 mmHg | |
| Molecular Formula | C18H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.2ºC | |
| Name | 4-[2-(butylamino)-1-hydroxyethyl]phenol,pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 375.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.39400 |
| Flash Point | 141.2ºC |
| Exact Mass | 332.17400 |
| PSA | 102.68000 |
| LogP | 2.98600 |
| InChIKey | LAXWZPSLEWFPNP-UHFFFAOYSA-N |
| SMILES | CCCCNCC(O)c1ccc(O)cc1.O=C(O)c1cccnc1 |
| einecs 251-319-9 |