6-Chloro-N(2),N(4)-dicyclohexyl-1,3,5-triazine-2,4-diamine structure
|
Common Name | 6-Chloro-N(2),N(4)-dicyclohexyl-1,3,5-triazine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 32997-99-2 | Molecular Weight | 309.83800 | |
| Density | 1.264g/cm3 | Boiling Point | 494.3ºC at 760 mmHg | |
| Molecular Formula | C15H24ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.7ºC | |
| Name | 6-chloro-2-N,4-N-dicyclohexyl-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 494.3ºC at 760 mmHg |
| Molecular Formula | C15H24ClN5 |
| Molecular Weight | 309.83800 |
| Flash Point | 252.7ºC |
| Exact Mass | 309.17200 |
| PSA | 62.73000 |
| LogP | 4.16020 |
| Index of Refraction | 1.625 |
| InChIKey | YHVSDOGDOJTVJQ-UHFFFAOYSA-N |
| SMILES | Clc1nc(NC2CCCCC2)nc(NC2CCCCC2)n1 |
|
~%
6-Chloro-N(2),N... CAS#:32997-99-2 |
| Literature: AKZO NOBEL N.V. Patent: WO2005/11703 A1, 2005 ; Location in patent: Page/Page column 24 ; |
|
~%
6-Chloro-N(2),N... CAS#:32997-99-2 |
| Literature: Ghosh, Surajit Kumar; Saha, Ashmita; Hazarika, Bornali; Singh, Udaya Pratap; Bhat, Hans Raj; Gahtori, Prashant Letters in Drug Design and Discovery, 2012 , vol. 9, # 3 p. 329 - 335 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 6-chloro-N,N'-dicyclohexyl-[1,3,5]triazine-2,4-diamine |
| 6-chloro-N(2),N(4)-dicyclohexyl-1,3,5-triazine-2,4-diamine |
| 6-Chlor-N2,N4-dicyclohexyl-[1,3,5]triazin-2,4-diyldiamin |
| 6-chloro-N2,N4-dicyclohexyl-[1,3,5]triazine-2,4-diyldiamine |
| 2-Chlor-4,6-dicyclohexylamino-s-triazin |
| 6-Chloro-N,N'-(cyclohexyl)-[1,3,5]triazine-2,4-diamine |