Fluorobis(phenylamino)phosphine oxide structure
|
Common Name | Fluorobis(phenylamino)phosphine oxide | ||
|---|---|---|---|---|
| CAS Number | 330-08-5 | Molecular Weight | 250.20900 | |
| Density | 1.346g/cm3 | Boiling Point | 359.7ºC at 760 mmHg | |
| Molecular Formula | C12H12FN2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.4ºC | |
| Name | N-[anilino(fluoro)phosphoryl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.346g/cm3 |
|---|---|
| Boiling Point | 359.7ºC at 760 mmHg |
| Molecular Formula | C12H12FN2OP |
| Molecular Weight | 250.20900 |
| Flash Point | 171.4ºC |
| Exact Mass | 250.06700 |
| PSA | 50.94000 |
| LogP | 4.43420 |
| Index of Refraction | 1.645 |
| InChIKey | FPLZAICQNAEAND-UHFFFAOYSA-N |
| SMILES | O=P(F)(Nc1ccccc1)Nc1ccccc1 |
|
~%
Fluorobis(pheny... CAS#:330-08-5 |
| Literature: Cook et al. Journal of the Chemical Society, 1949 , p. 2921,2925 |
|
~%
Fluorobis(pheny... CAS#:330-08-5 |
| Literature: Heap; Saunders Journal of the Chemical Society, 1948 , p. 1315 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N,N'-diphenyl-diamidophosphoryl fluoride |
| N,N'-Diphenylphosphorodiamidic fluoride |
| Dianilinofluorophosphine oxide |
| N,N'-Diphenyl-diamidophosphorylfluorid |
| N.N'-Diphenyl-diamidophosphorsaeure-fluorid |
| Phosphorodiamidic fluoride,N,N'-diphenyl |