2,2'-[thiobis(methylene)]bis-1H-benzimidazole structure
|
Common Name | 2,2'-[thiobis(methylene)]bis-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 33007-61-3 | Molecular Weight | 294.37400 | |
| Density | 1.413g/cm3 | Boiling Point | 635.6ºC at 760mmHg | |
| Molecular Formula | C16H14N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.2ºC | |
| Name | 2-(1H-benzimidazol-2-ylmethylsulfanylmethyl)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.413g/cm3 |
|---|---|
| Boiling Point | 635.6ºC at 760mmHg |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.37400 |
| Flash Point | 338.2ºC |
| Exact Mass | 294.09400 |
| PSA | 82.66000 |
| LogP | 3.87260 |
| Index of Refraction | 1.799 |
| InChIKey | PLROPLMRAPJFHZ-UHFFFAOYSA-N |
| SMILES | c1ccc2[nH]c(CSCc3nc4ccccc4[nH]3)nc2c1 |
| HS Code | 2933990090 |
|---|
|
~85%
2,2'-[thiobis(m... CAS#:33007-61-3 |
| Literature: Hasaninejad, Alireza; Niknam, Khodabakhsh; Zare, Abdolkarim; Farsimadan, Ehsan; Shekouhy, Mohsen Phosphorus, Sulfur and Silicon and the Related Elements, 2009 , vol. 184, # 1 p. 147 - 155 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 251-335-6 |