5-amino-2-(2,4-dichloro-6-methoxyphenyl)-2,4-dihydro-3H-pyrazol-3-one structure
|
Common Name | 5-amino-2-(2,4-dichloro-6-methoxyphenyl)-2,4-dihydro-3H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 33008-67-2 | Molecular Weight | 274.10300 | |
| Density | 1.6g/cm3 | Boiling Point | 425.3ºC at 760mmHg | |
| Molecular Formula | C10H9Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211ºC | |
| Name | 5-amino-2-(2,4-dichloro-6-methoxyphenyl)-4H-pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 425.3ºC at 760mmHg |
| Molecular Formula | C10H9Cl2N3O2 |
| Molecular Weight | 274.10300 |
| Flash Point | 211ºC |
| Exact Mass | 273.00700 |
| PSA | 65.42000 |
| LogP | 2.71410 |
| Index of Refraction | 1.67 |
| InChIKey | OHOJALQXKVUGNB-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)cc(Cl)c1N1N=C(N)CC1=O |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 251-339-8 |