5-O-Methylirilone structure
|
Common Name | 5-O-Methylirilone | ||
|---|---|---|---|---|
| CAS Number | 3301-68-6 | Molecular Weight | 312.27400 | |
| Density | 1.466g/cm3 | Boiling Point | 552.7ºC at 760 mmHg | |
| Molecular Formula | C17H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.9ºC | |
| Name | 7-(4-hydroxyphenyl)-9-methoxy-[1,3]dioxolo[4,5-g]chromen-8-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 552.7ºC at 760 mmHg |
| Molecular Formula | C17H12O6 |
| Molecular Weight | 312.27400 |
| Flash Point | 209.9ºC |
| Exact Mass | 312.06300 |
| PSA | 78.13000 |
| LogP | 2.90290 |
| Index of Refraction | 1.663 |
| InChIKey | RSSZOUXCQUJNKL-UHFFFAOYSA-N |
| SMILES | COc1c2c(cc3occ(-c4ccc(O)cc4)c(=O)c13)OCO2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-methoxy-4'-hydroxy-6,7-methylenedioxyisoflavone |
| 4'-Hydroxy-5-methoxy-6,7-methylendioxy-isoflavon |
| sosan |
| Irisolone |