2-(4-benzylpiperazin-1-yl)-1H-quinazolin-4-one structure
|
Common Name | 2-(4-benzylpiperazin-1-yl)-1H-quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 33017-91-3 | Molecular Weight | 320.38800 | |
| Density | 1.26g/cm3 | Boiling Point | 484.3ºC at 760 mmHg | |
| Molecular Formula | C19H20N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.7ºC | |
| Name | 2-(4-benzylpiperazin-1-yl)-1H-quinazolin-4-one |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 484.3ºC at 760 mmHg |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.38800 |
| Flash Point | 246.7ºC |
| Exact Mass | 320.16400 |
| PSA | 52.49000 |
| LogP | 2.66050 |
| Index of Refraction | 1.673 |
| InChIKey | PNLNMKQYPUQOIC-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(N2CCN(Cc3ccccc3)CC2)nc2ccccc12 |
|
~28%
2-(4-benzylpipe... CAS#:33017-91-3 |
| Literature: ASTRAZENECA AB Patent: WO2007/108743 A2, 2007 ; Location in patent: Page/Page column 44 ; WO 2007/108743 A2 |
|
~87%
2-(4-benzylpipe... CAS#:33017-91-3 |
| Literature: Hori; Iemura; Hara; Ozaki; Sukamoto; Ohtaka Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 3 p. 681 - 687 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |