2-[5-(3-methylpiperazin-1-yl)-2-nitroanilino]ethanol structure
|
Common Name | 2-[5-(3-methylpiperazin-1-yl)-2-nitroanilino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 330177-51-0 | Molecular Weight | 280.32300 | |
| Density | 1.256g/cm3 | Boiling Point | 526ºC at 760 mmHg | |
| Molecular Formula | C13H20N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.9ºC | |
| Name | 2-[5-(3-methylpiperazin-1-yl)-2-nitroanilino]ethanol |
|---|
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 526ºC at 760 mmHg |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.32300 |
| Flash Point | 271.9ºC |
| Exact Mass | 280.15400 |
| PSA | 93.35000 |
| LogP | 1.78710 |
| Index of Refraction | 1.605 |
| InChIKey | LWKATNRNJGJLAS-UHFFFAOYSA-N |
| SMILES | CC1CN(c2ccc([N+](=O)[O-])c(NCCO)c2)CCN1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |