3-(2-adamantyl)-1-(2-fluoroethyl)urea structure
|
Common Name | 3-(2-adamantyl)-1-(2-fluoroethyl)urea | ||
|---|---|---|---|---|
| CAS Number | 33021-83-9 | Molecular Weight | 240.31700 | |
| Density | 1.15g/cm3 | Boiling Point | 421.7ºC at 760 mmHg | |
| Molecular Formula | C13H21FN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.9ºC | |
| Name | 1-(2-adamantyl)-3-(2-fluoroethyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 421.7ºC at 760 mmHg |
| Molecular Formula | C13H21FN2O |
| Molecular Weight | 240.31700 |
| Flash Point | 208.9ºC |
| Exact Mass | 240.16400 |
| PSA | 41.13000 |
| LogP | 2.86160 |
| Index of Refraction | 1.524 |
| InChIKey | DUSFLQCEUXZSMO-UHFFFAOYSA-N |
| SMILES | O=C(NCCF)NC1C2CC3CC(C2)CC1C3 |
|
~%
3-(2-adamantyl)... CAS#:33021-83-9 |
| Literature: Johnston; McCaleb; Opliger; Laster; Montgomery Journal of medicinal chemistry, 1971 , vol. 14, # 17 p. 600 - 614 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-(2-fluoroethyl)-3-tricyclo[3.3.1.13,7]dec-2-ylurea |
| N-Adamantan-2-yl-N'-(2-fluor-aethyl)-harnstoff |