2,3,4,4'-tetrachlorobiphenyl structure
|
Common Name | 2,3,4,4'-tetrachlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 33025-41-1 | Molecular Weight | 291.98800 | |
| Density | 1.441g/cm3 | Boiling Point | 362.4ºC at 760mmHg | |
| Molecular Formula | C12H6Cl4 | Melting Point | 142°C | |
| MSDS | N/A | Flash Point | 174.9ºC | |
| Name | 2,3,4,4'-tetrachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.441g/cm3 |
|---|---|
| Boiling Point | 362.4ºC at 760mmHg |
| Melting Point | 142°C |
| Molecular Formula | C12H6Cl4 |
| Molecular Weight | 291.98800 |
| Flash Point | 174.9ºC |
| Exact Mass | 289.92200 |
| LogP | 5.96720 |
| Index of Refraction | 1.612 |
| InChIKey | XLDBTRJKXLKYTC-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2ccc(Cl)c(Cl)c2Cl)cc1 |
| HS Code | 2903999010 |
|---|
| HS Code | 2903999010 |
|---|---|
| Summary | 2903999010 2,3,3',4,5,6-hexachloro-1,1'-biphenyl。supervision conditions:89(articles on the list of prohibited export goods,articles on the list of prohibited import goods)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:5.5%。general tariff:30.0% |
| PCB 60 |
| 1,1'-Biphenyl,2,3,4,4'-tetrachloro |
| 2,3,4,4'-TCB |
| 2,3,3',4-Tetrachlorobiphenyl |
| 1,2,3-trichloro-4-(4-chlorophenyl)benzene |
| 2,3,4,4'-TETRACHLOROBIPHENYL |
| 2,3,4,4'-Tetrachloro-1,1'-biphenyl |