6-Hydroxy-2-(4-hydroxyphenyl)-5,7-dimethoxy-4H-chromen-4-one
Modify Date: 2025-08-27 15:27:25
6-Hydroxy-2-(4-hydroxyphenyl)-5,7-dimethoxy-4H-chromen-4-one structure
|
Common Name | 6-Hydroxy-2-(4-hydroxyphenyl)-5,7-dimethoxy-4H-chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 33028-99-8 | Molecular Weight | 314.28900 | |
| Density | 1.402g/cm3 | Boiling Point | 586.8ºC at 760 mmHg | |
| Molecular Formula | C17H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.8ºC | |
| Name | 4',6-dihydroxy-5,7-dimethoxyflavone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 586.8ºC at 760 mmHg |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.28900 |
| Flash Point | 220.8ºC |
| Exact Mass | 314.07900 |
| PSA | 89.13000 |
| LogP | 2.88840 |
| Index of Refraction | 1.645 |
| InChIKey | NFSSFGJGSUAWLF-UHFFFAOYSA-N |
| SMILES | COc1cc2oc(-c3ccc(O)cc3)cc(=O)c2c(OC)c1O |
| HS Code | 2914509090 |
|---|
|
~%
6-Hydroxy-2-(4-... CAS#:33028-99-8 |
| Literature: Zemplen et al. Acta Chimica Academiae Scientiarum Hungaricae, 1958 , vol. 16, p. 445,447 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4',6-Dihydroxy-5,7-dimethoxyflavone |
| scutellarein 5,7-dimethyl ether |
| 6-hydroxy-2-(4-hydroxyphenyl)-5,7-dimethoxychromen-4-one |