Asparticacid, N-carboxy-, N-benzyl 4-methyl 1-p-nitrophenylester (6CI,7CI,8CI) structure
|
Common Name | Asparticacid, N-carboxy-, N-benzyl 4-methyl 1-p-nitrophenylester (6CI,7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 3304-57-2 | Molecular Weight | 402.35500 | |
| Density | 1.348g/cm3 | Boiling Point | 598ºC at 760mmHg | |
| Molecular Formula | C19H18N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.5ºC | |
| Name | phenylcarbamic acid benzyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 598ºC at 760mmHg |
| Molecular Formula | C19H18N2O8 |
| Molecular Weight | 402.35500 |
| Flash Point | 315.5ºC |
| Exact Mass | 402.10600 |
| PSA | 136.75000 |
| LogP | 3.27240 |
| Index of Refraction | 1.577 |
| InChIKey | JEIMHXFAMSWVSI-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(NC(=O)OCc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
|
~%
Asparticacid, N... CAS#:3304-57-2 |
| Literature: Kovacs,J. et al. Journal of Organic Chemistry, 1973 , vol. 38, p. 2518 - 2521 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzyl phenylcarbamate |
| N-Benzyloxycarbonylaminobenzene |
| benzyloxycarbonylaniline |
| N-benzyloxycarbonylaniline |
| benzyl N-phenyl carbamate |
| O-benzyl N-phenyl carbamate |