(3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione
Modify Date: 2026-07-24 11:39:56
(3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione structure
|
Common Name | (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 33045-33-9 | Molecular Weight | 206.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H10N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H10N2O2S2 |
|---|---|
| Molecular Weight | 206.3 |
| InChIKey | CMFNIAJHZXCKBJ-PHDIDXHHSA-N |
| SMILES | CN1C(=O)C(S)N(C)C(=O)C1S |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione? |
| A: InChIKey of (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione is CMFNIAJHZXCKBJ-PHDIDXHHSA-N. |
| Q: What is the English name of (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione? |
| A: The English name of (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione is (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione. |
| Q: What is the molecular weight of (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione? |
| A: Molecular weight of (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione is 206.3. |
| Q: What is the CAS number of (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione? |
| A: CAS number of (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione is 33045-33-9. |
| Q: What is the molecular formula of (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione? |
| A: Molecular formula of (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione is C6H10N2O2S2. |
| Q: What is the Chinese name of 33045-33-9? |
| A: Chinese name of 33045-33-9 is 33045-33-9. |
| Q: What is the SMILES notation of (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione? |
| A: SMILES notation of (3R,6R)-1,4-Dimethyl-3,6-bis(sulfanyl)piperazine-2,5-dione is CN1C(=O)C(S)N(C)C(=O)C1S. |