3,4-DIMETHOXY-3,5,7-TRIHYDROXYFLAVONE structure
|
Common Name | 3,4-DIMETHOXY-3,5,7-TRIHYDROXYFLAVONE | ||
|---|---|---|---|---|
| CAS Number | 3306-29-4 | Molecular Weight | 330.28900 | |
| Density | 1.507g/cm3 | Boiling Point | 562.2ºC at 760mmHg | |
| Molecular Formula | C17H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.5ºC | |
| Name | 2-(3,4-dimethoxyphenyl)-3,5,7-trihydroxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.507g/cm3 |
|---|---|
| Boiling Point | 562.2ºC at 760mmHg |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.28900 |
| Flash Point | 209.5ºC |
| Exact Mass | 330.07400 |
| PSA | 109.36000 |
| LogP | 2.59400 |
| Index of Refraction | 1.681 |
| InChIKey | MHALJYZRPGYQSI-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1OC |
| HS Code | 2914509090 |
|---|
|
~91%
3,4-DIMETHOXY-3... CAS#:3306-29-4 |
| Literature: Shi, Zhi-Hao; Li, Nian-Guang; Tang, Yu-Ping; Wei-Li; Lian-Yin; Yang, Jian-Ping; Hao-Tang; Duan, Jin-Ao European Journal of Medicinal Chemistry, 2012 , vol. 54, p. 210 - 222 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-(3,4-dimethoxy-phenyl)-3,5,7-trihydroxy-chromen-4-one |
| Dillenetin |
| 3',4'-O-dimethylquercetin |
| 3',4'-Dimethoxyquercetin |
| 3',4'-dimethylquercetin |
| UNII-S3Z5LJ2T0Y |
| 2-(3,4-dimethoxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one |
| 3,5,7-trihydroxy-3',4'-dimethoxyflavone |
| quercetin-3',4'-dimethyl ether |