2-(Dimethylamino)-3',4'-dimethoxyacetophenone structure
|
Common Name | 2-(Dimethylamino)-3',4'-dimethoxyacetophenone | ||
|---|---|---|---|---|
| CAS Number | 33061-24-4 | Molecular Weight | 223.26800 | |
| Density | 1.067g/cm3 | Boiling Point | 330.8ºC at 760mmHg | |
| Molecular Formula | C12H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.9ºC | |
| Name | 1-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethanone |
|---|
| Density | 1.067g/cm3 |
|---|---|
| Boiling Point | 330.8ºC at 760mmHg |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.26800 |
| Flash Point | 153.9ºC |
| Exact Mass | 223.12100 |
| PSA | 38.77000 |
| LogP | 1.44810 |
| Index of Refraction | 1.51 |
| InChIKey | HFQMZHBEAQBKQW-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CN(C)C)cc1OC |
| HS Code | 2922509090 |
|---|
|
~80%
2-(Dimethylamin... CAS#:33061-24-4 |
| Literature: Tetrahedron Asymmetry, , vol. 20, # 10 p. 1138 - 1143 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |