3-Hydroxybutano-4-lactone structure
|
Common Name | 3-Hydroxybutano-4-lactone | ||
|---|---|---|---|---|
| CAS Number | 3307-37-7 | Molecular Weight | 249.09100 | |
| Density | 1.372g/cm3 | Boiling Point | 415.6ºC at 760mmHg | |
| Molecular Formula | C10H10Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4-db |
|---|---|
| Synonym | More Synonyms |
| Density | 1.372g/cm3 |
|---|---|
| Boiling Point | 415.6ºC at 760mmHg |
| Molecular Formula | C10H10Cl2O3 |
| Molecular Weight | 249.09100 |
| Exact Mass | 248.00100 |
| PSA | 46.53000 |
| LogP | 3.23700 |
| Index of Refraction | 1.554 |
| InChIKey | AKDSUKZFDDKNNM-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCOc1ccc(Cl)c(Cl)c1 |
| HS Code | 2918990090 |
|---|
|
~91%
3-Hydroxybutano... CAS#:3307-37-7 |
| Literature: Lagu, Bharat; Wachter, Michael Patent: US2006/293379 A1, 2006 ; Location in patent: Page/Page column 85 ; US 20060293379 A1 |
|
~%
3-Hydroxybutano... CAS#:3307-37-7 |
| Literature: May and Baker Ltd. Patent: US2866816 , 1956 ; |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(3,4-dichlorophenoxy)butanoic acid |
| 4-(3,4-dichlorophenoxy)butyric acid |