N-phenyl-1H-2,1,4-benzothiadiazin-3-amine structure
|
Common Name | N-phenyl-1H-2,1,4-benzothiadiazin-3-amine | ||
|---|---|---|---|---|
| CAS Number | 33077-30-4 | Molecular Weight | 241.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-phenyl-1H-2,1,4-benzothiadiazin-3-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11N3S |
|---|---|
| Molecular Weight | 241.31200 |
| Exact Mass | 241.06700 |
| PSA | 72.18000 |
| LogP | 3.35210 |
| InChIKey | DEVKLPKCURJHRV-UHFFFAOYSA-N |
| SMILES | c1ccc(NC2=Nc3ccccc3NS2)cc1 |
|
~%
N-phenyl-1H-2,1... CAS#:33077-30-4 |
| Literature: Ghosh; Guha Journal of the Indian Chemical Society, 1929 , vol. 6, p. 193 Chem. Zentralbl., 1929 , vol. 100, # II p. 1012 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1H-2,1,4-Benzothiadiazin-3-amine,N-phenyl |