(2,4-Dimethoxyphenyl)(2-methoxyphenyl)methanone structure
|
Common Name | (2,4-Dimethoxyphenyl)(2-methoxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 33077-87-1 | Molecular Weight | 272.296 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 444.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | 55.5-59.5ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 197.9±28.8 °C | |
| Name | (2,4-dimethoxyphenyl)-(2-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 444.0±45.0 °C at 760 mmHg |
| Melting Point | 55.5-59.5ºC(lit.) |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.296 |
| Flash Point | 197.9±28.8 °C |
| Exact Mass | 272.104858 |
| PSA | 44.76000 |
| LogP | 3.06 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | FUGHBBQOPVKADC-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccccc2OC)c(OC)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914509090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4,2'-trimethoxy-benzophenone |
| Trimethoxy-2.2'.4' benzophenon |
| (2,4-Dimethoxyphenyl)(2-methoxyphenyl)methanone |
| 2,2',4,4',6-PENTABROMODIPHENYL ETHER |
| Methanone, (2,4-dimethoxyphenyl)(2-methoxyphenyl)- |
| 2,4,2'-Trimethoxy-benzophenon |
| 2,2',4-Trimethoxybenzophenone |