2-[2-(4-ethoxyphenoxy)benzimidazol-1-yl]-N,N-diethylethanamine
Modify Date: 2025-09-15 14:44:20
![2-[2-(4-ethoxyphenoxy)benzimidazol-1-yl]-N,N-diethylethanamine Structure](https://image.chemsrc.com/caspic/419/3308-28-9.png)
2-[2-(4-ethoxyphenoxy)benzimidazol-1-yl]-N,N-diethylethanamine structure
|
Common Name | 2-[2-(4-ethoxyphenoxy)benzimidazol-1-yl]-N,N-diethylethanamine | ||
|---|---|---|---|---|
| CAS Number | 3308-28-9 | Molecular Weight | 353.45800 | |
| Density | 1.09g/cm3 | Boiling Point | 495.8ºC at 760 mmHg | |
| Molecular Formula | C21H27N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.7ºC | |
| Name | 2-[2-(4-ethoxyphenoxy)benzimidazol-1-yl]-N,N-diethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 495.8ºC at 760 mmHg |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.45800 |
| Flash Point | 253.7ºC |
| Exact Mass | 353.21000 |
| PSA | 39.52000 |
| LogP | 4.56910 |
| Index of Refraction | 1.565 |
| InChIKey | CKMCJEWCPZECIB-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(Oc2nc3ccccc3n2CCN(CC)CC)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-<4-Aethoxy-phenoxy>-1-<2-diaethylamino-aethyl>-benzimidazol |