Urea,N-(2-chloroethyl)-N'-(1,1-dimethyl-2-phenylethyl)- structure
|
Common Name | Urea,N-(2-chloroethyl)-N'-(1,1-dimethyl-2-phenylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 33082-80-3 | Molecular Weight | 254.75600 | |
| Density | 1.103g/cm3 | Boiling Point | 435.3ºC at 760 mmHg | |
| Molecular Formula | C13H19ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217ºC | |
| Name | 1-(2-chloroethyl)-3-(2-methyl-1-phenylpropan-2-yl)urea |
|---|
| Density | 1.103g/cm3 |
|---|---|
| Boiling Point | 435.3ºC at 760 mmHg |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.75600 |
| Flash Point | 217ºC |
| Exact Mass | 254.11900 |
| PSA | 41.13000 |
| LogP | 3.32750 |
| Index of Refraction | 1.526 |
| InChIKey | KNNXGYCEUVHRSD-UHFFFAOYSA-N |
| SMILES | CC(C)(Cc1ccccc1)NC(=O)NCCCl |
|
~%
Urea,N-(2-chlor... CAS#:33082-80-3 |
| Literature: Johnston; McCaleb; Opliger; Laster; Montgomery Journal of medicinal chemistry, 1971 , vol. 14, # 17 p. 600 - 614 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |