Urea,N-(2-chloroethyl)-N'-(4,4-dimethylcyclohexyl)- structure
|
Common Name | Urea,N-(2-chloroethyl)-N'-(4,4-dimethylcyclohexyl)- | ||
|---|---|---|---|---|
| CAS Number | 33082-83-6 | Molecular Weight | 232.75000 | |
| Density | 1.07g/cm3 | Boiling Point | 381.6ºC at 760mmHg | |
| Molecular Formula | C11H21ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.6ºC | |
| Name | 1-(2-chloroethyl)-3-(4,4-dimethylcyclohexyl)urea |
|---|
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 381.6ºC at 760mmHg |
| Molecular Formula | C11H21ClN2O |
| Molecular Weight | 232.75000 |
| Flash Point | 184.6ºC |
| Exact Mass | 232.13400 |
| PSA | 41.13000 |
| LogP | 3.27500 |
| Index of Refraction | 1.494 |
| InChIKey | UDCBXHXSSQCWBC-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC(NC(=O)NCCCl)CC1 |
|
~%
Urea,N-(2-chlor... CAS#:33082-83-6 |
| Literature: Johnston; McCaleb; Opliger; Laster; Montgomery Journal of medicinal chemistry, 1971 , vol. 14, # 17 p. 600 - 614 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |