ethyl 1-(2-chloroethylcarbamoylamino)-2-methyl-cyclohexane-1-carboxylate structure
|
Common Name | ethyl 1-(2-chloroethylcarbamoylamino)-2-methyl-cyclohexane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 33082-89-2 | Molecular Weight | 290.78600 | |
| Density | 1.15g/cm3 | Boiling Point | 440.5ºC at 760 mmHg | |
| Molecular Formula | C13H23ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.2ºC | |
| Name | ethyl 1-(2-chloroethylcarbamoylamino)-2-methylcyclohexane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 440.5ºC at 760 mmHg |
| Molecular Formula | C13H23ClN2O3 |
| Molecular Weight | 290.78600 |
| Flash Point | 220.2ºC |
| Exact Mass | 290.14000 |
| PSA | 67.43000 |
| LogP | 2.81820 |
| Index of Refraction | 1.499 |
| InChIKey | BZJKPCWTIOHFOX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(NC(=O)NCCCl)CCCCC1C |
|
~%
ethyl 1-(2-chlo... CAS#:33082-89-2 |
| Literature: Johnston; McCaleb; Opliger; Laster; Montgomery Journal of medicinal chemistry, 1971 , vol. 14, # 17 p. 600 - 614 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Opt.-inakt. N-<1-Aethoxycarbonyl-2-methyl-cyclohexyl>-N'-<2-chlor-aethyl>-harnstoff |