3-(4,6-dimethylquinolin-2-yl)sulfanylpropanoic acid structure
|
Common Name | 3-(4,6-dimethylquinolin-2-yl)sulfanylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 330832-52-5 | Molecular Weight | 261.33900 | |
| Density | 1.26g/cm3 | Boiling Point | 468.8ºC at 760 mmHg | |
| Molecular Formula | C14H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.3ºC | |
| Name | 3-(4,6-dimethylquinolin-2-yl)sulfanylpropanoic acid |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 468.8ºC at 760 mmHg |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.33900 |
| Flash Point | 237.3ºC |
| Exact Mass | 261.08200 |
| PSA | 75.49000 |
| LogP | 3.41840 |
| Index of Refraction | 1.645 |
| InChIKey | DZGHJKPVJUIMED-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(SCCC(=O)O)cc(C)c2c1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |