4-[3-(4-phenylmethoxyphenyl)prop-2-enoyl]benzonitrile structure
|
Common Name | 4-[3-(4-phenylmethoxyphenyl)prop-2-enoyl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 33084-01-4 | Molecular Weight | 339.38700 | |
| Density | 1.2g/cm3 | Boiling Point | 563.4ºC at 760mmHg | |
| Molecular Formula | C23H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.1ºC | |
| Name | 4-[3-(4-phenylmethoxyphenyl)prop-2-enoyl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 563.4ºC at 760mmHg |
| Molecular Formula | C23H17NO2 |
| Molecular Weight | 339.38700 |
| Flash Point | 242.1ºC |
| Exact Mass | 339.12600 |
| PSA | 50.09000 |
| LogP | 5.03338 |
| Index of Refraction | 1.639 |
| InChIKey | FKMBGHGEEKGDHP-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C(=O)C=Cc2ccc(OCc3ccccc3)cc2)cc1 |
| HS Code | 2926909090 |
|---|
|
~%
4-[3-(4-phenylm... CAS#:33084-01-4 |
| Literature: Merchant,J.R. et al. Journal of the Indian Chemical Society, 1971 , vol. 48, p. 483 - 489 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Benzyloxy-4'-cyan-chalkon |