Benzonitrile,4-[1-oxo-3-(3,4,5-trimethoxyphenyl)-2-propen-1-yl]- structure
|
Common Name | Benzonitrile,4-[1-oxo-3-(3,4,5-trimethoxyphenyl)-2-propen-1-yl]- | ||
|---|---|---|---|---|
| CAS Number | 33084-02-5 | Molecular Weight | 323.34300 | |
| Density | 1.21g/cm3 | Boiling Point | 519ºC at 760mmHg | |
| Molecular Formula | C19H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.5ºC | |
| Name | 4-[(Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 519ºC at 760mmHg |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.34300 |
| Flash Point | 224.5ºC |
| Exact Mass | 323.11600 |
| PSA | 68.55000 |
| LogP | 3.48018 |
| Index of Refraction | 1.585 |
| InChIKey | QCCNRRJVSUTKEE-TWGQIWQCSA-N |
| SMILES | COc1cc(C=CC(=O)c2ccc(C#N)cc2)cc(OC)c1OC |
|
~%
Benzonitrile,4-... CAS#:33084-02-5 |
| Literature: Merchant,J.R. et al. Journal of the Indian Chemical Society, 1971 , vol. 48, p. 483 - 489 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,4,5-Trimethoxy-4'-cyan-chalkon |