Phosphoric acid 2,2-dichloroethenyl 2,3-dichloropropylethyl ester structure
|
Common Name | Phosphoric acid 2,2-dichloroethenyl 2,3-dichloropropylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 3309-67-9 | Molecular Weight | 331.94600 | |
| Density | 1.464g/cm3 | Boiling Point | 318.4ºC at 760 mmHg | |
| Molecular Formula | C7H11Cl4O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | 2,2-dichloroethenyl 2,3-dichloropropyl ethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 318.4ºC at 760 mmHg |
| Molecular Formula | C7H11Cl4O4P |
| Molecular Weight | 331.94600 |
| Flash Point | 197.9ºC |
| Exact Mass | 329.91500 |
| PSA | 54.57000 |
| LogP | 4.28690 |
| Index of Refraction | 1.492 |
| InChIKey | BHFXPVGYEDGFFF-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OC=C(Cl)Cl)OCC(Cl)CCl |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| SD 1996 |
| ENT 25,689 |
| Phosphoric acid,2,2-dichloroethenyl 2,3-dichloropropyl ethyl ester |
| Shell SD-1996 |