N-[2-(ethylcarbamoylformyl)phenyl]acetamide structure
|
Common Name | N-[2-(ethylcarbamoylformyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 33090-81-2 | Molecular Weight | 234.25100 | |
| Density | 1.213g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-acetamidophenyl)-N-ethyl-2-oxoacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25100 |
| Exact Mass | 234.10000 |
| PSA | 75.27000 |
| LogP | 1.42770 |
| Index of Refraction | 1.571 |
| InChIKey | FEVYRGRTVLTATC-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C(=O)c1ccccc1NC(C)=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-[2-(ETHYLCARBAMOYLFORMYL)PHENYL]ACETAMIDE |
| 2-[2-(acetylamino)phenyl]-n-ethyl-2-oxoacetamide |