Prmt5-in-c17
Modify Date: 2025-11-09 00:18:39
Prmt5-in-c17 structure
|
Common Name | Prmt5-in-c17 | ||
|---|---|---|---|---|
| CAS Number | 330951-01-4 | Molecular Weight | 371.411 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Prmt5-in-c17PRMT5-IN-C17 is a novel potent, selective, and cell active protein arginine methyltransferase 5 (PRMT5) inhibitor. |
| Name | PRMT5-IN-C17 |
|---|
| Description | PRMT5-IN-C17 is a novel potent, selective, and cell active protein arginine methyltransferase 5 (PRMT5) inhibitor. |
|---|
| Molecular Formula | C18H17N3O4S |
|---|---|
| Molecular Weight | 371.411 |
| InChIKey | GZBULYAKSCNNPA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(=O)CSc1nc2ccc(OC)cc2[nH]1 |