2-(4-methyl-6-piperazin-1-ylpyrimidin-2-yl)phenol(SALTDATA: HCl) structure
|
Common Name | 2-(4-methyl-6-piperazin-1-ylpyrimidin-2-yl)phenol(SALTDATA: HCl) | ||
|---|---|---|---|---|
| CAS Number | 330982-03-1 | Molecular Weight | 270.33000 | |
| Density | 1.205g/cm3 | Boiling Point | 404.6ºC at 760 mmHg | |
| Molecular Formula | C15H18N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.5ºC | |
| Name | 2-(4-methyl-6-piperazin-1-ylpyrimidin-2-yl)phenol() |
|---|
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 404.6ºC at 760 mmHg |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.33000 |
| Flash Point | 198.5ºC |
| Exact Mass | 270.14800 |
| PSA | 61.28000 |
| LogP | 1.96100 |
| Index of Refraction | 1.605 |
| InChIKey | LSBFDECOGCIELU-UHFFFAOYSA-N |
| SMILES | Cc1cc(N2CCNCC2)nc(-c2ccccc2O)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |