2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate
Modify Date: 2026-09-27 20:26:46
2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate structure
|
Common Name | 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 331-01-1 | Molecular Weight | 263.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12F3NO3 |
|---|---|
| Molecular Weight | 263.21 |
| InChIKey | WWLUHZQJCAWASF-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(NC(=O)OCC(F)(F)F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate? |
| A: InChIKey of 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate is WWLUHZQJCAWASF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 331-01-1? |
| A: Chinese name of 331-01-1 is CCOc1ccc(NC(=O)OCC(F)(F)F)cc1. |
| Q: What is the English name of 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate? |
| A: The English name of 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate is 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate. |
| Q: What is the molecular weight of 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate? |
| A: Molecular weight of 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate is 263.21. |
| Q: What is the molecular formula of 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate? |
| A: Molecular formula of 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate is C11H12F3NO3. |
| Q: What is the CAS number of 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate? |
| A: CAS number of 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate is 331-01-1. |
| Q: What is the SMILES notation of 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate? |
| A: SMILES notation of 2,2,2-trifluoroethyl N-(4-ethoxyphenyl)carbamate is CCOc1ccc(NC(=O)OCC(F)(F)F)cc1. |