1-prop-2-enyl-3-[3-(trifluoromethyl)phenyl]thiourea structure
|
Common Name | 1-prop-2-enyl-3-[3-(trifluoromethyl)phenyl]thiourea | ||
|---|---|---|---|---|
| CAS Number | 331-37-3 | Molecular Weight | 260.27900 | |
| Density | 1.296g/cm3 | Boiling Point | 286.9ºC at 760 mmHg | |
| Molecular Formula | C11H11F3N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.3ºC | |
| Name | 1-prop-2-enyl-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 286.9ºC at 760 mmHg |
| Molecular Formula | C11H11F3N2S |
| Molecular Weight | 260.27900 |
| Flash Point | 127.3ºC |
| Exact Mass | 260.06000 |
| PSA | 56.15000 |
| LogP | 3.64170 |
| Index of Refraction | 1.564 |
| InChIKey | GERKUUFIHDIPNL-UHFFFAOYSA-N |
| SMILES | C=CCNC(=S)Nc1cccc(C(F)(F)F)c1 |
|
~%
1-prop-2-enyl-3... CAS#:331-37-3 |
| Literature: Burger; Hornbaker Journal of Organic Chemistry, 1953 , vol. 18, p. 192,194 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-Allyl-N'-(3-trifluormethyl-phenyl)-thioharnstoff |
| N-allyl-N'-(3-trifluoromethyl-phenyl)-thiourea |