L-Balenine structure
|
Common Name | L-Balenine | ||
|---|---|---|---|---|
| CAS Number | 331-38-4 | Molecular Weight | 240.25900 | |
| Density | 1.38g/cm3 | Boiling Point | 611.3ºC at 760mmHg | |
| Molecular Formula | C10H16N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.5ºC | |
| Name | 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 611.3ºC at 760mmHg |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.25900 |
| Flash Point | 323.5ºC |
| Exact Mass | 240.12200 |
| PSA | 113.23000 |
| LogP | 0.10910 |
| Index of Refraction | 1.615 |
| InChIKey | SLRNWACWRVGMKD-QMMMGPOBSA-N |
| SMILES | Cn1cnc(CC(NC(=O)CCN)C(=O)O)c1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Nbeta-Alanyl-1-methyl-histidine |