diethyl 2,3-diazabicyclo[2.2.2]octane-2,3-dicarboxylate structure
|
Common Name | diethyl 2,3-diazabicyclo[2.2.2]octane-2,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 3310-59-6 | Molecular Weight | 256.29800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2,3-diazabicyclo[2.2.2]octane-2,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H20N2O4 |
|---|---|
| Molecular Weight | 256.29800 |
| Exact Mass | 256.14200 |
| PSA | 59.08000 |
| LogP | 2.01900 |
| InChIKey | YONPROBZRZEFNO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1C2CCC(CC2)N1C(=O)OCC |
|
~99%
diethyl 2,3-dia... CAS#:3310-59-6 |
| Literature: Mellor, John M.; Smith, Neil M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 12 p. 2927 - 2931 |
|
~%
diethyl 2,3-dia... CAS#:3310-59-6 |
| Literature: Mellor, John M.; Smith, Neil M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 12 p. 2927 - 2931 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| diethyl 2,3-diazabicyclo<2.2.2>octane-2,3-dicarboxylate |
| 2,3-Diaza-bicyclo<2.2.2>octan-2,3-dicarbonsaeure-diethylester |
| 2,3-Diethoxycarbonyl-2,3-diaza-bicyclo<2.2.2>octan |