5-(4-nitrophenyl)-2-phenyl-3,4-dihydropyrazole structure
|
Common Name | 5-(4-nitrophenyl)-2-phenyl-3,4-dihydropyrazole | ||
|---|---|---|---|---|
| CAS Number | 3314-41-8 | Molecular Weight | 267.28300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(4-nitrophenyl)-2-phenyl-3,4-dihydropyrazole |
|---|
| Molecular Formula | C15H13N3O2 |
|---|---|
| Molecular Weight | 267.28300 |
| Exact Mass | 267.10100 |
| PSA | 61.42000 |
| LogP | 3.23300 |
| InChIKey | MHGHKCBKUYUBGT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C2=NN(c3ccccc3)CC2)cc1 |
| HS Code | 2933199090 |
|---|
|
~%
5-(4-nitropheny... CAS#:3314-41-8 |
| Literature: Wheatley et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 4490 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |