2-Methoxy-N-(2-methoxybenzyl)benzamide structure
|
Common Name | 2-Methoxy-N-(2-methoxybenzyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 331440-01-8 | Molecular Weight | 271.31100 | |
| Density | 1.137g/cm3 | Boiling Point | 455.2ºC at 760 mmHg | |
| Molecular Formula | C16H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.1ºC | |
| Name | 2-Methoxy-N-(2-methoxybenzyl)benzamide |
|---|
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 455.2ºC at 760 mmHg |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.31100 |
| Flash Point | 229.1ºC |
| Exact Mass | 271.12100 |
| PSA | 51.05000 |
| LogP | 3.20860 |
| Index of Refraction | 1.565 |
| InChIKey | LWWIFEXSJWVDBN-UHFFFAOYSA-N |
| SMILES | COc1ccccc1CNC(=O)c1ccccc1OC |
|
~62%
2-Methoxy-N-(2-... CAS#:331440-01-8 |
| Literature: Calderone, Vincenzo; Fiamingo, Francesca Lidia; Amato, Gabriella; Giorgi, Irene; Livi, Oreste; Martelli, Alma; Martinotti, Enrica European Journal of Medicinal Chemistry, 2008 , vol. 43, # 4 p. 792 - 799 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |