Phenol,4,4'-(phenylmethylene)bis[2-(1,1-dimethylethyl)-5-methyl structure
|
Common Name | Phenol,4,4'-(phenylmethylene)bis[2-(1,1-dimethylethyl)-5-methyl | ||
|---|---|---|---|---|
| CAS Number | 3315-25-1 | Molecular Weight | 416.59500 | |
| Density | 1.053g/cm3 | Boiling Point | 515ºC at 760mmHg | |
| Molecular Formula | C29H36O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.4ºC | |
| Name | 2-tert-butyl-4-[(5-tert-butyl-4-hydroxy-2-methylphenyl)-phenylmethyl]-5-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.053g/cm3 |
|---|---|
| Boiling Point | 515ºC at 760mmHg |
| Molecular Formula | C29H36O2 |
| Molecular Weight | 416.59500 |
| Flash Point | 213.4ºC |
| Exact Mass | 416.27200 |
| PSA | 40.46000 |
| LogP | 7.48980 |
| Index of Refraction | 1.572 |
| InChIKey | PIMTXXZXQGDRGI-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(C(C)(C)C)cc1C(c1ccccc1)c1cc(C(C)(C)C)c(O)cc1C |
|
~27%
Phenol,4,4'-(ph... CAS#:3315-25-1 |
| Literature: Yamada; Nishiyama; Yamamoto; Tanaka Bulletin of the Chemical Society of Japan, 1989 , vol. 62, # 11 p. 3603 - 3608 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,2'-Di-tert-butyl-5,5'-dimethyl-4,4'-benzyliden-di-phenol |
| 4,4'-benzylidenebis(2-t-butyl-5-methylphenol) |
| 2,2'-di-tert-butyl-5,5'-dimethyl-4,4'-benzylidene-di-phenol |