2-(2-ETHOXYETHOXY)ANILINE structure
|
Common Name | 2-(2-ETHOXYETHOXY)ANILINE | ||
|---|---|---|---|---|
| CAS Number | 331657-28-4 | Molecular Weight | 292.16200 | |
| Density | 1.268g/cm3 | Boiling Point | 404.1ºC at 760 mmHg | |
| Molecular Formula | C11H15Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.2ºC | |
| Name | 1-(4-Chloro-2-nitrophenyl)-3-methylpiperazine hydrochloride |
|---|
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 404.1ºC at 760 mmHg |
| Molecular Formula | C11H15Cl2N3O2 |
| Molecular Weight | 292.16200 |
| Flash Point | 198.2ºC |
| Exact Mass | 291.05400 |
| PSA | 61.09000 |
| LogP | 3.76530 |
| Index of Refraction | 1.568 |
| InChIKey | GIRKMKZFBUAZMN-UHFFFAOYSA-N |
| SMILES | CC1CN(c2ccc(Cl)cc2[N+](=O)[O-])CCN1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |