6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione
Modify Date: 2025-09-11 21:23:41
6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione structure
|
Common Name | 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione | ||
|---|---|---|---|---|
| CAS Number | 33166-93-7 | Molecular Weight | 206.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7FN2O2 |
|---|---|
| Molecular Weight | 206.17 |
| InChIKey | QCMJILJPLXALSM-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccc(F)cc2)[nH]c(=O)[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione? |
| A: SMILES notation of 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione is O=c1cc(-c2ccc(F)cc2)[nH]c(=O)[nH]1. |
| Q: What is the InChIKey of 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione? |
| A: InChIKey of 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione is QCMJILJPLXALSM-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 33166-93-7? |
| A: Chinese name of 33166-93-7 is 33166-93-7. |
| Q: What is the molecular weight of 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione? |
| A: Molecular weight of 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione is 206.17. |
| Q: What is the English name of 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione? |
| A: The English name of 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione is 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione. |
| Q: What is the molecular formula of 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione? |
| A: Molecular formula of 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione is C10H7FN2O2. |
| Q: What is the CAS number of 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione? |
| A: CAS number of 6-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione is 33166-93-7. |