7-(3-(4-chlorophenoxy)-2-hydroxypropyl)-3-methyl-8-(methylthio)-1H-purine-2,6(3H,7H)-dione structure
|
Common Name | 7-(3-(4-chlorophenoxy)-2-hydroxypropyl)-3-methyl-8-(methylthio)-1H-purine-2,6(3H,7H)-dione | ||
|---|---|---|---|---|
| CAS Number | 331675-32-2 | Molecular Weight | 396.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17ClN4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(3-(4-chlorophenoxy)-2-hydroxypropyl)-3-methyl-8-(methylthio)-1H-purine-2,6(3H,7H)-dione |
|---|
| Molecular Formula | C16H17ClN4O4S |
|---|---|
| Molecular Weight | 396.8 |
| InChIKey | WJECIOJJNINSCK-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)NC1=O)N(C(=N2)SC)CC(COC3=CC=C(C=C3)Cl)O |
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|