(5-chloro-2-methylphenyl)-phenylmethanone structure
|
Common Name | (5-chloro-2-methylphenyl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 33184-55-3 | Molecular Weight | 230.69000 | |
| Density | 1.178g/cm3 | Boiling Point | 331.8ºC at 760mmHg | |
| Molecular Formula | C14H11ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.3ºC | |
| Name | (5-chloro-2-methylphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.178g/cm3 |
|---|---|
| Boiling Point | 331.8ºC at 760mmHg |
| Molecular Formula | C14H11ClO |
| Molecular Weight | 230.69000 |
| Flash Point | 185.3ºC |
| Exact Mass | 230.05000 |
| PSA | 17.07000 |
| LogP | 3.87940 |
| Index of Refraction | 1.586 |
| InChIKey | MEILSOQVXNYFTC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)cc1C(=O)c1ccccc1 |
|
~%
(5-chloro-2-met... CAS#:33184-55-3 |
| Literature: Ciba-Geigy Corporation Patent: US4022801 A1, 1977 ; |
|
~%
(5-chloro-2-met... CAS#:33184-55-3 |
| Literature: Aeberli,P. et al. Journal of Medicinal Chemistry, 1975 , vol. 18, # 2 p. 177 - 182 |
|
~%
(5-chloro-2-met... CAS#:33184-55-3 |
| Literature: AGFA Patent: DE267271 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 201 |
|
~%
(5-chloro-2-met... CAS#:33184-55-3 |
| Literature: de Diesbach; Dobbelmann Helvetica Chimica Acta, 1931 , vol. 14, p. 369,375 |
| 5-chloro-2-methylbenzophenone |
| 5-Chlor-2-methyl-benzophenon |
| 2-Methyl-5-chloro-benzophenon |