cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate
Modify Date: 2026-07-19 10:51:10
cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate structure
|
Common Name | cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 331846-42-5 | Molecular Weight | 227.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21NO3 |
|---|---|
| Molecular Weight | 227.30 |
| InChIKey | AFMMHVFSLJYZKE-RKDXNWHRSA-N |
| SMILES | CC1CN(C(=O)OC(C)(C)C)C(C)CC1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate? |
| A: InChIKey of cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate is AFMMHVFSLJYZKE-RKDXNWHRSA-N. |
| Q: What is the SMILES notation of cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate? |
| A: SMILES notation of cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate is CC1CN(C(=O)OC(C)(C)C)C(C)CC1=O. |
| Q: What is the Chinese name of 331846-42-5? |
| A: Chinese name of 331846-42-5 is 331846-42-5. |
| Q: What is the CAS number of cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate? |
| A: CAS number of cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate is 331846-42-5. |
| Q: What is the molecular weight of cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate? |
| A: Molecular weight of cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate is 227.30. |
| Q: What is the English name of cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate? |
| A: The English name of cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate is cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate. |
| Q: What is the molecular formula of cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate? |
| A: Molecular formula of cis-tert-Butyl 2,5-dimethyl-4-oxopiperidine-1-carboxylate is C12H21NO3. |