(r)-3-amino-4-(2,4-dichlorophenyl)butanoic acid hydrochloride structure
|
Common Name | (r)-3-amino-4-(2,4-dichlorophenyl)butanoic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 331847-13-3 | Molecular Weight | 284.56700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (R)-3-Amino-4-(2,4-dichlorophenyl)-butanoic acid hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12Cl3NO2 |
|---|---|
| Molecular Weight | 284.56700 |
| Exact Mass | 282.99300 |
| PSA | 63.32000 |
| LogP | 3.84020 |
| InChIKey | JNGZEMBEPQATGG-DDWIOCJRSA-N |
| SMILES | Cl.NC(CC(=O)O)Cc1ccc(Cl)cc1Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| rarechem ak pt 0042 |