N1-isopentyl-N2-(thiazol-2-yl)oxalamide
Modify Date: 2026-06-08 23:10:18
N1-isopentyl-N2-(thiazol-2-yl)oxalamide structure
|
Common Name | N1-isopentyl-N2-(thiazol-2-yl)oxalamide | ||
|---|---|---|---|---|
| CAS Number | 331981-93-2 | Molecular Weight | 241.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N1-isopentyl-N2-(thiazol-2-yl)oxalamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15N3O2S |
|---|---|
| Molecular Weight | 241.31 |
| InChIKey | JSCOVTSHGXQFJM-UHFFFAOYSA-N |
| SMILES | CC(C)CCNC(=O)C(=O)NC1=NC=CS1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Fluorescence-based counterscreen assay for HCV NS3 helicase inhibitors of a ChemBridg...
Source: 1102
Target: N/A
External Id: 20130627FPNS3INTERFERECB
|
|
Name: Fluorescence polarization based primary biochemical high throughput screening assay o...
Source: 1102
Target: NS3 [Hepatitis C virus]
External Id: 20130624FPNS3DACB
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N1-isopentyl-N2-(thiazol-2-yl)oxalamide? |
| A: Molecular weight of N1-isopentyl-N2-(thiazol-2-yl)oxalamide is 241.31. |
| Q: What is the molecular formula of N1-isopentyl-N2-(thiazol-2-yl)oxalamide? |
| A: Molecular formula of N1-isopentyl-N2-(thiazol-2-yl)oxalamide is C10H15N3O2S. |
| Q: What is the English name of N1-isopentyl-N2-(thiazol-2-yl)oxalamide? |
| A: The English name of N1-isopentyl-N2-(thiazol-2-yl)oxalamide is N1-isopentyl-N2-(thiazol-2-yl)oxalamide. |
| Q: What is the CAS number of N1-isopentyl-N2-(thiazol-2-yl)oxalamide? |
| A: CAS number of N1-isopentyl-N2-(thiazol-2-yl)oxalamide is 331981-93-2. |
| Q: What is the SMILES notation of N1-isopentyl-N2-(thiazol-2-yl)oxalamide? |
| A: SMILES notation of N1-isopentyl-N2-(thiazol-2-yl)oxalamide is CC(C)CCNC(=O)C(=O)NC1=NC=CS1. |
| Q: What is the Chinese name of 331981-93-2? |
| A: Chinese name of 331981-93-2 is 331981-93-2. |
| Q: What is the InChIKey of N1-isopentyl-N2-(thiazol-2-yl)oxalamide? |
| A: InChIKey of N1-isopentyl-N2-(thiazol-2-yl)oxalamide is JSCOVTSHGXQFJM-UHFFFAOYSA-N. |