N-(3,5-Dimethylbicyclo[4.2.0]octa-1,3,5-trien-7-yl)propanamide structure
|
Common Name | N-(3,5-Dimethylbicyclo[4.2.0]octa-1,3,5-trien-7-yl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 33213-02-4 | Molecular Weight | 203.28000 | |
| Density | 1.06g/cm3 | Boiling Point | 397.1ºC at 760 mmHg | |
| Molecular Formula | C13H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.1ºC | |
| Name | N-(3,5-dimethyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanamide |
|---|
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 397.1ºC at 760 mmHg |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28000 |
| Flash Point | 238.1ºC |
| Exact Mass | 203.13100 |
| PSA | 29.10000 |
| LogP | 2.81770 |
| Index of Refraction | 1.552 |
| InChIKey | GWPVQPDUWYOJHX-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC1Cc2cc(C)cc(C)c21 |
|
~%
N-(3,5-Dimethyl... CAS#:33213-02-4 |
| Literature: Siciliano; Nieforth Journal of medicinal chemistry, 1971 , vol. 14, # 17 p. 645 - 646 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |