1-(3-nitrophenyl)-N-(1,3-thiazol-4-ylmethoxy)methanimine structure
|
Common Name | 1-(3-nitrophenyl)-N-(1,3-thiazol-4-ylmethoxy)methanimine | ||
|---|---|---|---|---|
| CAS Number | 33215-68-8 | Molecular Weight | 263.27200 | |
| Density | 1.39g/cm3 | Boiling Point | 435.6ºC at 760 mmHg | |
| Molecular Formula | C11H9N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.2ºC | |
| Name | 3-nitro-benzaldehyde O-thiazol-4-ylmethyl-oxime |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 435.6ºC at 760 mmHg |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.27200 |
| Flash Point | 217.2ºC |
| Exact Mass | 263.03600 |
| PSA | 108.54000 |
| LogP | 3.12520 |
| Index of Refraction | 1.654 |
| InChIKey | YYIGVLCURLGMTK-ACAGNQJTSA-N |
| SMILES | O=[N+]([O-])c1cccc(C=NOCc2cscn2)c1 |
|
~%
1-(3-nitropheny... CAS#:33215-68-8 |
| Literature: Hamor; Watson Journal of pharmaceutical sciences, 1971 , vol. 60, # 6 p. 925 - 927 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (3-Nitro-benzal)-semicarbazid |
| m-nitrobenzaldehyde neopentyl glycol acetal |
| 3-nitrobenzaldehyde semicarbazone |
| 3-Nitro-benzaldehyd-semicarbazon |
| m-Nitrobenzaldehyd-O-(4-thiazolylmethyl)-oxim |
| m-nitrobenzaldehyde semicarbazone |
| 5,5-dimethyl-2-(3'-nitrophenyl)-1,3-dioxane |