4-chloro-2-methyl-3-propylquinoline-6-carboxylic acid
Modify Date: 2025-11-25 08:46:43
4-chloro-2-methyl-3-propylquinoline-6-carboxylic acid structure
|
Common Name | 4-chloro-2-methyl-3-propylquinoline-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 332150-03-5 | Molecular Weight | 263.71900 | |
| Density | 1.274g/cm3 | Boiling Point | 397.9ºC at 760 mmHg | |
| Molecular Formula | C14H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.4ºC | |
| Name | 4-chloro-2-methyl-3-propylquinoline-6-carboxylic acid |
|---|
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 397.9ºC at 760 mmHg |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.71900 |
| Flash Point | 194.4ºC |
| Exact Mass | 263.07100 |
| PSA | 50.19000 |
| LogP | 3.84730 |
| Index of Refraction | 1.623 |
| InChIKey | RBHHKHINJXXXSY-UHFFFAOYSA-N |
| SMILES | CCCc1c(C)nc2ccc(C(=O)O)cc2c1Cl |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |