6-methoxy-2-methyl-3-(3-oxobutyl)-1H-quinolin-4-one structure
|
Common Name | 6-methoxy-2-methyl-3-(3-oxobutyl)-1H-quinolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 332150-27-3 | Molecular Weight | 259.30000 | |
| Density | 1.128g/cm3 | Boiling Point | 424ºC at 760 mmHg | |
| Molecular Formula | C15H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.2ºC | |
| Name | 6-methoxy-2-methyl-3-(3-oxobutyl)-1H-quinolin-4-one |
|---|
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 424ºC at 760 mmHg |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30000 |
| Flash Point | 210.2ºC |
| Exact Mass | 259.12100 |
| PSA | 59.42000 |
| LogP | 2.77900 |
| Index of Refraction | 1.534 |
| InChIKey | WPUANESYLXLGLX-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c(C)c(CCC(C)=O)c(=O)c2c1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |